C10H19N5S — CID 71752366
4-N-ethyl-2-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-6-methylsulfanyl-1,3,5-triazine-2,4-diamine (PubChem CID 71752366) has the molecular formula C10H19N5S and a molecular weight of 250.42 g/mol. Its IUPAC name is 4-N-ethyl-2-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-6-methylsulfanyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-ethyl-2-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-6-methylsulfanyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 71752366 |
| Molecular Formula | C10H19N5S |
| Molecular Weight | 250.42 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 4-N-ethyl-2-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-6-methylsulfanyl-1,3,5-triazine-2,4-diamine |
| SMILES | [2H]C([2H])([2H])C(Nc1nc(NCC)nc(SC)n1)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C10H19N5S/c1-6-11-7-12-8(15-10(2,3)4)14-9(13-7)16-5/h6H2,1-5H3,(H2,11,12,13,14,15)/i2D3,3D3,4D3 |
| InChIKey | IROINLKCQGIITA-WVZRYRIDSA-N |
| XLogP | 2.24 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |