C10H18AsN4S — CID 88729028
CID 88729028 (PubChem CID 88729028) has the molecular formula C10H18AsN4S and a molecular weight of 301.27 g/mol.
| Compound Name | CID 88729028 |
|---|---|
| PubChem CID | 88729028 |
| Molecular Formula | C10H18AsN4S |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | — |
| SMILES | CCNc1nc(SC)nc([As]C(C)(C)C)n1 |
| InChI | InChI=1S/C10H18AsN4S/c1-6-12-8-13-7(11-10(2,3)4)14-9(15-8)16-5/h6H2,1-5H3,(H,12,13,14,15) |
| InChIKey | VJSVHMNRCYMTNS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|