C15H20ClN7OS — CID 110190508
1-(4-chlorophenyl)-3-[[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]sulfanyl]urea (PubChem CID 110190508) has the molecular formula C15H20ClN7OS and a molecular weight of 381.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]sulfanyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]sulfanyl]urea |
|---|---|
| PubChem CID | 110190508 |
| Molecular Formula | C15H20ClN7OS |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]sulfanyl]urea |
| SMILES | CCNc1nc(NC(C)C)nc(SNC(=O)Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H20ClN7OS/c1-4-17-12-20-13(18-9(2)3)22-15(21-12)25-23-14(24)19-11-7-5-10(16)6-8-11/h5-9H,4H2,1-3H3,(H2,19,23,24)(H2,17,18,20,21,22) |
| InChIKey | ODSWYNRSUAIKQL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|