C17H24ClN7O2 — CID 23607064
1-(4-chlorophenyl)-3-[2-[[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]oxy]ethyl]urea (PubChem CID 23607064) has the molecular formula C17H24ClN7O2 and a molecular weight of 393.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-[[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]oxy]ethyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-[[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]oxy]ethyl]urea |
|---|---|
| PubChem CID | 23607064 |
| Molecular Formula | C17H24ClN7O2 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-[[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]oxy]ethyl]urea |
| SMILES | CCNc1nc(NC(C)C)nc(OCCNC(=O)Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H24ClN7O2/c1-4-19-14-23-15(21-11(2)3)25-17(24-14)27-10-9-20-16(26)22-13-7-5-12(18)6-8-13/h5-8,11H,4,9-10H2,1-3H3,(H2,20,22,26)(H2,19,21,23,24,25) |
| InChIKey | RGLZLHJBIXLZOM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|