C14H20Cl2N2O4 — CID 110192568
(4R)-5-(3,5-dichloroanilino)-4-hydroxy-5-oxopentanoate;propan-2-ylazanium (PubChem CID 110192568) has the molecular formula C14H20Cl2N2O4 and a molecular weight of 351.23 g/mol. Its IUPAC name is (4R)-5-(3,5-dichloroanilino)-4-hydroxy-5-oxopentanoate;propan-2-ylazanium.
| Compound Name | (4R)-5-(3,5-dichloroanilino)-4-hydroxy-5-oxopentanoate;propan-2-ylazanium |
|---|---|
| PubChem CID | 110192568 |
| Molecular Formula | C14H20Cl2N2O4 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (4R)-5-(3,5-dichloroanilino)-4-hydroxy-5-oxopentanoate;propan-2-ylazanium |
| SMILES | CC(C)[NH3+].O=C([O-])CC[C@@H](O)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO4.C3H9N/c12-6-3-7(13)5-8(4-6)14-11(18)9(15)1-2-10(16)17;1-3(2)4/h3-5,9,15H,1-2H2,(H,14,18)(H,16,17);3H,4H2,1-2H3/t9-;/m1./s1 |
| InChIKey | WMKNSPBOQPWWFX-SBSPUUFOSA-N |
| XLogP | 0.46 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |