C11H10Cl2KNO4 — CID 110192566
potassium (4R)-5-(3,5-dichloroanilino)-4-hydroxy-5-oxopentanoate (PubChem CID 110192566) has the molecular formula C11H10Cl2KNO4 and a molecular weight of 330.21 g/mol. Its IUPAC name is potassium (4R)-5-(3,5-dichloroanilino)-4-hydroxy-5-oxopentanoate.
| Compound Name | potassium (4R)-5-(3,5-dichloroanilino)-4-hydroxy-5-oxopentanoate |
|---|---|
| PubChem CID | 110192566 |
| Molecular Formula | C11H10Cl2KNO4 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | potassium (4R)-5-(3,5-dichloroanilino)-4-hydroxy-5-oxopentanoate |
| SMILES | O=C([O-])CC[C@@H](O)C(=O)Nc1cc(Cl)cc(Cl)c1.[K+] |
| InChI | InChI=1S/C11H11Cl2NO4.K/c12-6-3-7(13)5-8(4-6)14-11(18)9(15)1-2-10(16)17;/h3-5,9,15H,1-2H2,(H,14,18)(H,16,17);/q;+1/p-1/t9-;/m1./s1 |
| InChIKey | RNGRTQDIUHAQMK-SBSPUUFOSA-M |
| XLogP | -2.17 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |