C26H44N4O2 — CID 110194812
(5R,6R,9S,13S)-N-cyclohexyl-6-[4-(cyclopropylmethylamino)-4-oxobutyl]-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide (PubChem CID 110194812) has the molecular formula C26H44N4O2 and a molecular weight of 444.66 g/mol. Its IUPAC name is (5R,6R,9S,13S)-N-cyclohexyl-6-[4-(cyclopropylmethylamino)-4-oxobutyl]-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide.
| Compound Name | (5R,6R,9S,13S)-N-cyclohexyl-6-[4-(cyclopropylmethylamino)-4-oxobutyl]-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide |
|---|---|
| PubChem CID | 110194812 |
| Molecular Formula | C26H44N4O2 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.35 |
| IUPAC Name | (5R,6R,9S,13S)-N-cyclohexyl-6-[4-(cyclopropylmethylamino)-4-oxobutyl]-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide |
| SMILES | O=C(CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1C(=O)NC1CCCCC1)[C@@H]23)NCC1CC1 |
| InChI | InChI=1S/C26H44N4O2/c31-24(27-17-19-13-14-19)12-4-11-23-22-10-6-16-29-15-5-7-20(25(22)29)18-30(23)26(32)28-21-8-2-1-3-9-21/h19-23,25H,1-18H2,(H,27,31)(H,28,32)/t20-,22+,23+,25-/m0/s1 |
| InChIKey | CJWPYDAFFFGKGP-QSHYMPABSA-N |
| XLogP | 3.90 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |