C15H14FN3O2S — CID 110196576
(1R,9S)-12-(4-fluorophenyl)sulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 110196576) has the molecular formula C15H14FN3O2S and a molecular weight of 319.36 g/mol. Its IUPAC name is (1R,9S)-12-(4-fluorophenyl)sulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1R,9S)-12-(4-fluorophenyl)sulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 110196576 |
| Molecular Formula | C15H14FN3O2S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (1R,9S)-12-(4-fluorophenyl)sulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1[C@H]2CC[C@@H]1c1cncnc1C2 |
| InChI | InChI=1S/C15H14FN3O2S/c16-10-1-4-12(5-2-10)22(20,21)19-11-3-6-15(19)13-8-17-9-18-14(13)7-11/h1-2,4-5,8-9,11,15H,3,6-7H2/t11-,15+/m0/s1 |
| InChIKey | UPQXUSRYVARFAX-XHDPSFHLSA-N |
| XLogP | 2.07 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |