C14H24O2 — CID 11020550
2-methyl-3-methylidene-2-(2-methylpropyl)-6-prop-2-enoxyoxane (PubChem CID 11020550) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-methyl-3-methylidene-2-(2-methylpropyl)-6-prop-2-enoxyoxane.
| Compound Name | 2-methyl-3-methylidene-2-(2-methylpropyl)-6-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 11020550 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2-methyl-3-methylidene-2-(2-methylpropyl)-6-prop-2-enoxyoxane |
| SMILES | C=CCOC1CCC(=C)C(C)(CC(C)C)O1 |
| InChI | InChI=1S/C14H24O2/c1-6-9-15-13-8-7-12(4)14(5,16-13)10-11(2)3/h6,11,13H,1,4,7-10H2,2-3,5H3 |
| InChIKey | NIAQDNPOWSLACW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|