C15H26O4 — CID 67864645
2-(dimethoxymethyl)-6-methoxy-2,5-bis(prop-2-enyl)oxane (PubChem CID 67864645) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-(dimethoxymethyl)-6-methoxy-2,5-bis(prop-2-enyl)oxane.
| Compound Name | 2-(dimethoxymethyl)-6-methoxy-2,5-bis(prop-2-enyl)oxane |
|---|---|
| PubChem CID | 67864645 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-(dimethoxymethyl)-6-methoxy-2,5-bis(prop-2-enyl)oxane |
| SMILES | C=CCC1CCC(CC=C)(C(OC)OC)OC1OC |
| InChI | InChI=1S/C15H26O4/c1-6-8-12-9-11-15(10-7-2,14(17-4)18-5)19-13(12)16-3/h6-7,12-14H,1-2,8-11H2,3-5H3 |
| InChIKey | DEHOWWLQEIRQJA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|