C12H18O4 — CID 11020586
[(E)-3-(5,5-dimethyl-4-oxooxolan-2-yl)but-2-enyl] acetate (PubChem CID 11020586) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is [(E)-3-(5,5-dimethyl-4-oxooxolan-2-yl)but-2-enyl] acetate.
| Compound Name | [(E)-3-(5,5-dimethyl-4-oxooxolan-2-yl)but-2-enyl] acetate |
|---|---|
| PubChem CID | 11020586 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | [(E)-3-(5,5-dimethyl-4-oxooxolan-2-yl)but-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)C1CC(=O)C(C)(C)O1 |
| InChI | InChI=1S/C12H18O4/c1-8(5-6-15-9(2)13)10-7-11(14)12(3,4)16-10/h5,10H,6-7H2,1-4H3/b8-5+ |
| InChIKey | CAIFJHYJMSNKQD-VMPITWQZSA-N |
| XLogP | 1.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|