C19H25NO5S — CID 110205913
N-[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 110205913) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 110205913 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | CSCC[C@@H](CO)NC(=O)COc1ccc2c(C)c(C)c(=O)oc2c1C |
| InChI | InChI=1S/C19H25NO5S/c1-11-12(2)19(23)25-18-13(3)16(6-5-15(11)18)24-10-17(22)20-14(9-21)7-8-26-4/h5-6,14,21H,7-10H2,1-4H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | KQVAWPHAIIGKTG-AWEZNQCLSA-N |
| XLogP | 2.33 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|