C25H35N3O6 — CID 73256610
3-methyl-N-propan-2-yl-2-[[2-[[2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetyl]amino]acetyl]amino]pentanamide (PubChem CID 73256610) has the molecular formula C25H35N3O6 and a molecular weight of 473.57 g/mol. Its IUPAC name is 3-methyl-N-propan-2-yl-2-[[2-[[2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetyl]amino]acetyl]amino]pentanamide.
| Compound Name | 3-methyl-N-propan-2-yl-2-[[2-[[2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetyl]amino]acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 73256610 |
| Molecular Formula | C25H35N3O6 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 3-methyl-N-propan-2-yl-2-[[2-[[2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetyl]amino]acetyl]amino]pentanamide |
| SMILES | CCC(C)C(NC(=O)CNC(=O)COc1ccc2c(C)c(C)c(=O)oc2c1C)C(=O)NC(C)C |
| InChI | InChI=1S/C25H35N3O6/c1-8-14(4)22(24(31)27-13(2)3)28-20(29)11-26-21(30)12-33-19-10-9-18-15(5)16(6)25(32)34-23(18)17(19)7/h9-10,13-14,22H,8,11-12H2,1-7H3,(H,26,30)(H,27,31)(H,28,29) |
| InChIKey | OOQLOZUKWKSXRE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|