C35H40N6O6 — CID 110206726
(2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]butanamide (PubChem CID 110206726) has the molecular formula C35H40N6O6 and a molecular weight of 640.74 g/mol. Its IUPAC name is (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]butanamide.
| Compound Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 110206726 |
| Molecular Formula | C35H40N6O6 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(N[C@H](C(=O)Nc3ccc(Cn4cncn4)cc3)C(C)C)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C35H40N6O6/c1-20(2)32(35(44)39-24-10-7-22(8-11-24)17-41-19-36-18-37-41)40-28-14-12-25-26(16-29(28)43)27(38-21(3)42)13-9-23-15-30(45-4)33(46-5)34(47-6)31(23)25/h7-8,10-12,14-16,18-20,27,32H,9,13,17H2,1-6H3,(H,38,42)(H,39,44)(H,40,43)/t27-,32-/m0/s1 |
| InChIKey | JNRKPWCOISCQCM-UCGGBYDDSA-N |
| XLogP | 4.58 |
| TPSA | 145.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |