C25H28N4O2 — CID 110212532
CID 110212532 (PubChem CID 110212532) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol.
| Compound Name | CID 110212532 |
|---|---|
| PubChem CID | 110212532 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)NC1(COC3(CCN(Cc4cccnc4)CC3)C1)c1cccn1-2 |
| InChI | InChI=1S/C25H28N4O2/c1-30-20-6-7-22-21(14-20)27-25(23-5-3-11-29(22)23)17-24(31-18-25)8-12-28(13-9-24)16-19-4-2-10-26-15-19/h2-7,10-11,14-15,27H,8-9,12-13,16-18H2,1H3 |
| InChIKey | NEICZSMYELBTSD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |