C28H33N3O2 — CID 95794118
CID 95794118 (PubChem CID 95794118) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol.
| Compound Name | CID 95794118 |
|---|---|
| PubChem CID | 95794118 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)N[C@@]1(COC3(CCN(CCCc4ccccc4)CC3)C1)c1cccn1-2 |
| InChI | InChI=1S/C28H33N3O2/c1-32-23-11-12-25-24(19-23)29-28(26-10-6-16-31(25)26)20-27(33-21-28)13-17-30(18-14-27)15-5-9-22-7-3-2-4-8-22/h2-4,6-8,10-12,16,19,29H,5,9,13-15,17-18,20-21H2,1H3/t28-/m0/s1 |
| InChIKey | XQVNUWKBBLYIRK-NDEPHWFRSA-N |
| XLogP | 4.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |