C24H25N3O4 — CID 110212601
CID 110212601 (PubChem CID 110212601) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol.
| Compound Name | CID 110212601 |
|---|---|
| PubChem CID | 110212601 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)NC1(COC3(CCN(C(=O)c4ccco4)CC3)C1)c1cccn1-2 |
| InChI | InChI=1S/C24H25N3O4/c1-29-17-6-7-19-18(14-17)25-24(21-5-2-10-27(19)21)15-23(31-16-24)8-11-26(12-9-23)22(28)20-4-3-13-30-20/h2-7,10,13-14,25H,8-9,11-12,15-16H2,1H3 |
| InChIKey | KPXAYPDWLPWCOB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |