C26H27N3O3 — CID 95794161
CID 95794161 (PubChem CID 95794161) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol.
| Compound Name | CID 95794161 |
|---|---|
| PubChem CID | 95794161 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | — |
| SMILES | COc1ccccc1C(=O)N1CCC2(CC1)C[C@]1(CO2)Nc2ccccc2-n2cccc21 |
| InChI | InChI=1S/C26H27N3O3/c1-31-22-10-5-2-7-19(22)24(30)28-15-12-25(13-16-28)17-26(18-32-25)23-11-6-14-29(23)21-9-4-3-8-20(21)27-26/h2-11,14,27H,12-13,15-18H2,1H3/t26-/m1/s1 |
| InChIKey | VIUUTRJEGMFVJZ-AREMUKBSSA-N |
| XLogP | 4.20 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |