C24H28N6O3 — CID 110212622
CID 110212622 (PubChem CID 110212622) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol.
| Compound Name | CID 110212622 |
|---|---|
| PubChem CID | 110212622 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)NC1(COC3(CCN(C(=O)CCn4cncn4)CC3)C1)c1cccn1-2 |
| InChI | InChI=1S/C24H28N6O3/c1-32-18-4-5-20-19(13-18)27-24(21-3-2-9-30(20)21)14-23(33-15-24)7-11-28(12-8-23)22(31)6-10-29-17-25-16-26-29/h2-5,9,13,16-17,27H,6-8,10-12,14-15H2,1H3 |
| InChIKey | HLMQUGSCILHTCV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |