C25H33N3O3 — CID 95794206
CID 95794206 (PubChem CID 95794206) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol.
| Compound Name | CID 95794206 |
|---|---|
| PubChem CID | 95794206 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)N1CCC2(CC1)C[C@@]1(CO2)Nc2cc(OC)ccc2-n2cccc21 |
| InChI | InChI=1S/C25H33N3O3/c1-4-18(5-2)23(29)27-13-10-24(11-14-27)16-25(17-31-24)22-7-6-12-28(22)21-9-8-19(30-3)15-20(21)26-25/h6-9,12,15,18,26H,4-5,10-11,13-14,16-17H2,1-3H3/t25-/m0/s1 |
| InChIKey | YLOQTVOPCREIFU-VWLOTQADSA-N |
| XLogP | 4.32 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |