C25H26N4O4 — CID 95794222
CID 95794222 (PubChem CID 95794222) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol.
| Compound Name | CID 95794222 |
|---|---|
| PubChem CID | 95794222 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)N[C@@]1(COC3(CCN(C(=O)c4cncc(O)c4)CC3)C1)c1cccn1-2 |
| InChI | InChI=1S/C25H26N4O4/c1-32-19-4-5-21-20(12-19)27-25(22-3-2-8-29(21)22)15-24(33-16-25)6-9-28(10-7-24)23(31)17-11-18(30)14-26-13-17/h2-5,8,11-14,27,30H,6-7,9-10,15-16H2,1H3/t25-/m0/s1 |
| InChIKey | DSTROBHGNHEPAH-VWLOTQADSA-N |
| XLogP | 3.30 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |