About (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium
(E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium (PubChem CID 11022356) has the molecular formula C16H15N2O3+
and a molecular weight of 283.31 g/mol. Its IUPAC name is (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium.
Molecular Properties
| Compound Name | (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium |
| PubChem CID | 11022356 |
| Molecular Formula | C16H15N2O3+ |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium |
| SMILES | COc1ccccc1/C(O)=C(\[N+]#N)c1ccccc1OC |
| InChI | InChI=1S/C16H14N2O3/c1-20-13-9-5-3-7-11(13)15(18-17)16(19)12-8-4-6-10-14(12)21-2/h3-10H,1-2H3/p+1/b16-15+ |
| InChIKey | IEMARHSBYBPVOA-FOCLMDBBSA-O |
| XLogP | 3.94 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium?
The IUPAC name of (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium (CID 11022356) is (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium.
What is the SMILES notation for (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium?
The canonical SMILES for (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium is COc1ccccc1/C(O)=C(\[N+]#N)c1ccccc1OC.
What is the InChIKey of (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium?
The InChIKey is IEMARHSBYBPVOA-FOCLMDBBSA-O. The full InChI is InChI=1S/C16H14N2O3/c1-20-13-9-5-3-7-11(13)15(18-17)16(19)12-8-4-6-10-14(12)21-2/h3-10H,1-2H3/p+1/b16-15+.
What are the key properties of (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium?
(E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium has a molecular weight of 283.31 g/mol, XLogP of 3.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-hydroxy-1,2-bis(2-methoxyphenyl)ethenediazonium is sourced from PubChem (CID 11022356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).