C30H26O2S2 — CID 177470664
1-methoxy-2-[(1Z,3Z)-4-(2-methoxyphenyl)-1,4-bis(phenylsulfanyl)buta-1,3-dienyl]benzene (PubChem CID 177470664) has the molecular formula C30H26O2S2 and a molecular weight of 482.67 g/mol. Its IUPAC name is 1-methoxy-2-[(1Z,3Z)-4-(2-methoxyphenyl)-1,4-bis(phenylsulfanyl)buta-1,3-dienyl]benzene.
| Compound Name | 1-methoxy-2-[(1Z,3Z)-4-(2-methoxyphenyl)-1,4-bis(phenylsulfanyl)buta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 177470664 |
| Molecular Formula | C30H26O2S2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 1-methoxy-2-[(1Z,3Z)-4-(2-methoxyphenyl)-1,4-bis(phenylsulfanyl)buta-1,3-dienyl]benzene |
| SMILES | COc1ccccc1/C(=C/C=C(\Sc1ccccc1)c1ccccc1OC)Sc1ccccc1 |
| InChI | InChI=1S/C30H26O2S2/c1-31-27-19-11-9-17-25(27)29(33-23-13-5-3-6-14-23)21-22-30(34-24-15-7-4-8-16-24)26-18-10-12-20-28(26)32-2/h3-22H,1-2H3/b29-21-,30-22- |
| InChIKey | RAVCIFGCWLJUJE-DHQAUHHZSA-N |
| XLogP | 8.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|