C19H30O3 — CID 11023181
3-but-3-enyl-5-[2-(1,3-dioxan-2-yl)ethyl]-2,4,4-trimethylcyclohex-2-en-1-one (PubChem CID 11023181) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 3-but-3-enyl-5-[2-(1,3-dioxan-2-yl)ethyl]-2,4,4-trimethylcyclohex-2-en-1-one.
| Compound Name | 3-but-3-enyl-5-[2-(1,3-dioxan-2-yl)ethyl]-2,4,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11023181 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 3-but-3-enyl-5-[2-(1,3-dioxan-2-yl)ethyl]-2,4,4-trimethylcyclohex-2-en-1-one |
| SMILES | C=CCCC1=C(C)C(=O)CC(CCC2OCCCO2)C1(C)C |
| InChI | InChI=1S/C19H30O3/c1-5-6-8-16-14(2)17(20)13-15(19(16,3)4)9-10-18-21-11-7-12-22-18/h5,15,18H,1,6-13H2,2-4H3 |
| InChIKey | RLVAWSLFKFWZNY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|