C19H34O2Si — CID 11023723
2-[(1R)-1-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methylcyclobutyl]cyclohex-2-en-1-yl]acetaldehyde (PubChem CID 11023723) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is 2-[(1R)-1-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methylcyclobutyl]cyclohex-2-en-1-yl]acetaldehyde.
| Compound Name | 2-[(1R)-1-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methylcyclobutyl]cyclohex-2-en-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 11023723 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 2-[(1R)-1-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methylcyclobutyl]cyclohex-2-en-1-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@]1(C)[C@]1(CC=O)C=CCCC1 |
| InChI | InChI=1S/C19H34O2Si/c1-17(2,3)22(5,6)21-16-10-13-18(16,4)19(14-15-20)11-8-7-9-12-19/h8,11,15-16H,7,9-10,12-14H2,1-6H3/t16-,18+,19-/m1/s1 |
| InChIKey | SEFRDCLXAHPJGX-NZSAHSFTSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|