C22H38O2Si — CID 23254070
(1S,2S,4aS,5R,8aR)-2-[(E)-but-2-en-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde (PubChem CID 23254070) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is (1S,2S,4aS,5R,8aR)-2-[(E)-but-2-en-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde.
| Compound Name | (1S,2S,4aS,5R,8aR)-2-[(E)-but-2-en-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 23254070 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (1S,2S,4aS,5R,8aR)-2-[(E)-but-2-en-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde |
| SMILES | C/C=C(\C)[C@@H]1C=C[C@H]2[C@@H](CCC[C@H]2O[Si](C)(C)C(C)(C)C)[C@]1(C)C=O |
| InChI | InChI=1S/C22H38O2Si/c1-9-16(2)18-14-13-17-19(22(18,6)15-23)11-10-12-20(17)24-25(7,8)21(3,4)5/h9,13-15,17-20H,10-12H2,1-8H3/b16-9+/t17-,18-,19+,20+,22+/m0/s1 |
| InChIKey | REQRYPHIWJAUBS-NULXPYKBSA-N |
| XLogP | 6.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|