C18H30NO2+ — CID 11025107
[(E)-4-methoxy-3-methyl-4-oxobut-2-enyl]-dimethyl-(2-methyl-6-methylideneocta-1,7-dien-3-yl)azanium (PubChem CID 11025107) has the molecular formula C18H30NO2+ and a molecular weight of 292.44 g/mol. Its IUPAC name is [(E)-4-methoxy-3-methyl-4-oxobut-2-enyl]-dimethyl-(2-methyl-6-methylideneocta-1,7-dien-3-yl)azanium.
| Compound Name | [(E)-4-methoxy-3-methyl-4-oxobut-2-enyl]-dimethyl-(2-methyl-6-methylideneocta-1,7-dien-3-yl)azanium |
|---|---|
| PubChem CID | 11025107 |
| Molecular Formula | C18H30NO2+ |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | [(E)-4-methoxy-3-methyl-4-oxobut-2-enyl]-dimethyl-(2-methyl-6-methylideneocta-1,7-dien-3-yl)azanium |
| SMILES | C=CC(=C)CCC(C(=C)C)[N+](C)(C)C/C=C(\C)C(=O)OC |
| InChI | InChI=1S/C18H30NO2/c1-9-15(4)10-11-17(14(2)3)19(6,7)13-12-16(5)18(20)21-8/h9,12,17H,1-2,4,10-11,13H2,3,5-8H3/q+1/b16-12+ |
| InChIKey | CVNPVLVMXHVHMJ-FOWTUZBSSA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|