C26H36FN3O2 — CID 110260534
N-cyclohexyl-2-[4-[1-[(4-fluorophenyl)methyl]-7-oxo-5,6-dihydro-2H-azepin-6-yl]piperidin-1-yl]acetamide (PubChem CID 110260534) has the molecular formula C26H36FN3O2 and a molecular weight of 441.59 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-[1-[(4-fluorophenyl)methyl]-7-oxo-5,6-dihydro-2H-azepin-6-yl]piperidin-1-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[4-[1-[(4-fluorophenyl)methyl]-7-oxo-5,6-dihydro-2H-azepin-6-yl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 110260534 |
| Molecular Formula | C26H36FN3O2 |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | N-cyclohexyl-2-[4-[1-[(4-fluorophenyl)methyl]-7-oxo-5,6-dihydro-2H-azepin-6-yl]piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(C2CC=CCN(Cc3ccc(F)cc3)C2=O)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C26H36FN3O2/c27-22-11-9-20(10-12-22)18-30-15-5-4-8-24(26(30)32)21-13-16-29(17-14-21)19-25(31)28-23-6-2-1-3-7-23/h4-5,9-12,21,23-24H,1-3,6-8,13-19H2,(H,28,31) |
| InChIKey | PMLKGIXTQAMJOV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|