C22H25FN4O — CID 92619964
(6S)-1-[(4-fluorophenyl)methyl]-6-(1-pyrimidin-2-ylpiperidin-4-yl)-5,6-dihydro-2H-azepin-7-one (PubChem CID 92619964) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is (6S)-1-[(4-fluorophenyl)methyl]-6-(1-pyrimidin-2-ylpiperidin-4-yl)-5,6-dihydro-2H-azepin-7-one.
| Compound Name | (6S)-1-[(4-fluorophenyl)methyl]-6-(1-pyrimidin-2-ylpiperidin-4-yl)-5,6-dihydro-2H-azepin-7-one |
|---|---|
| PubChem CID | 92619964 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (6S)-1-[(4-fluorophenyl)methyl]-6-(1-pyrimidin-2-ylpiperidin-4-yl)-5,6-dihydro-2H-azepin-7-one |
| SMILES | O=C1[C@H](C2CCN(c3ncccn3)CC2)CC=CCN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN4O/c23-19-7-5-17(6-8-19)16-27-13-2-1-4-20(21(27)28)18-9-14-26(15-10-18)22-24-11-3-12-25-22/h1-3,5-8,11-12,18,20H,4,9-10,13-16H2/t20-/m0/s1 |
| InChIKey | HPBPNVUTKUNBOF-FQEVSTJZSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|