C18H25NO2 — CID 110281951
N-(cyclobutylmethyl)-2-(2,3-dihydro-1H-inden-5-yloxy)butanamide (PubChem CID 110281951) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-2-(2,3-dihydro-1H-inden-5-yloxy)butanamide.
| Compound Name | N-(cyclobutylmethyl)-2-(2,3-dihydro-1H-inden-5-yloxy)butanamide |
|---|---|
| PubChem CID | 110281951 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N-(cyclobutylmethyl)-2-(2,3-dihydro-1H-inden-5-yloxy)butanamide |
| SMILES | CCC(Oc1ccc2c(c1)CCC2)C(=O)NCC1CCC1 |
| InChI | InChI=1S/C18H25NO2/c1-2-17(18(20)19-12-13-5-3-6-13)21-16-10-9-14-7-4-8-15(14)11-16/h9-11,13,17H,2-8,12H2,1H3,(H,19,20) |
| InChIKey | NUAOIDCJDDIGKD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |