C19H22N2O5S — CID 110311283
3-(1,1-dioxothiazinan-2-yl)-N-(2-phenoxyethoxy)benzamide (PubChem CID 110311283) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-N-(2-phenoxyethoxy)benzamide.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-N-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 110311283 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-N-(2-phenoxyethoxy)benzamide |
| SMILES | O=C(NOCCOc1ccccc1)c1cccc(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C19H22N2O5S/c22-19(20-26-13-12-25-18-9-2-1-3-10-18)16-7-6-8-17(15-16)21-11-4-5-14-27(21,23)24/h1-3,6-10,15H,4-5,11-14H2,(H,20,22) |
| InChIKey | QXCUORQNEWANMA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|