C26H33N5O3 — CID 110311805
2-(4-ethoxy-3-nitrophenyl)-3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]imidazo[1,2-a]pyridin-6-amine (PubChem CID 110311805) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-(4-ethoxy-3-nitrophenyl)-3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]imidazo[1,2-a]pyridin-6-amine.
| Compound Name | 2-(4-ethoxy-3-nitrophenyl)-3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]imidazo[1,2-a]pyridin-6-amine |
|---|---|
| PubChem CID | 110311805 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 2-(4-ethoxy-3-nitrophenyl)-3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]imidazo[1,2-a]pyridin-6-amine |
| SMILES | CCOc1ccc(-c2nc3ccc(N)cn3c2CN2CC3(C)CC2CC(C)(C)C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H33N5O3/c1-5-34-22-8-6-17(10-20(22)31(32)33)24-21(30-13-18(27)7-9-23(30)28-24)14-29-16-26(4)12-19(29)11-25(2,3)15-26/h6-10,13,19H,5,11-12,14-16,27H2,1-4H3 |
| InChIKey | VRJRUFCOOQSISK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|