C20H34N2O3 — CID 110315298
tert-butyl N-[(2S)-1-[adamantane-1-carbonyl(methyl)amino]propan-2-yl]carbamate (PubChem CID 110315298) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[adamantane-1-carbonyl(methyl)amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[adamantane-1-carbonyl(methyl)amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 110315298 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | tert-butyl N-[(2S)-1-[adamantane-1-carbonyl(methyl)amino]propan-2-yl]carbamate |
| SMILES | C[C@@H](CN(C)C(=O)C12CC3CC(CC(C3)C1)C2)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H34N2O3/c1-13(21-18(24)25-19(2,3)4)12-22(5)17(23)20-9-14-6-15(10-20)8-16(7-14)11-20/h13-16H,6-12H2,1-5H3,(H,21,24)/t13-,14?,15?,16?,20?/m0/s1 |
| InChIKey | WGWSXZLAKYZQDP-IVKJLDKCSA-N |
| XLogP | 3.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |