C14H26OSi — CID 11031953
[(2R,3aS,6aR)-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11031953) has the molecular formula C14H26OSi and a molecular weight of 238.45 g/mol. Its IUPAC name is [(2R,3aS,6aR)-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3aS,6aR)-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11031953 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | [(2R,3aS,6aR)-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2CC=C[C@@H]2C1 |
| InChI | InChI=1S/C14H26OSi/c1-14(2,3)16(4,5)15-13-9-11-7-6-8-12(11)10-13/h6-7,11-13H,8-10H2,1-5H3/t11-,12+,13+/m1/s1 |
| InChIKey | JMMABLNHTGRKJT-AGIUHOORSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|