C19H34O4Si — CID 11035630
methyl (1R,2S,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-naphthalene-1-carboxylate (PubChem CID 11035630) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is methyl (1R,2S,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-naphthalene-1-carboxylate.
| Compound Name | methyl (1R,2S,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11035630 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | methyl (1R,2S,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-naphthalene-1-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2[C@H](CCC[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)C[C@@H]1C |
| InChI | InChI=1S/C19H34O4Si/c1-12-11-14(20)13-9-8-10-15(17(13)16(12)18(21)22-5)23-24(6,7)19(2,3)4/h12-13,15-17H,8-11H2,1-7H3/t12-,13+,15+,16+,17+/m0/s1 |
| InChIKey | VHBSVZCPLPDOAU-IHWGESPNSA-N |
| XLogP | 4.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|