C24H48O4Si — CID 11037372
(2S,3R,6S)-6-[(1S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-2-[(E)-dec-1-enyl]oxan-3-ol (PubChem CID 11037372) has the molecular formula C24H48O4Si and a molecular weight of 428.73 g/mol. Its IUPAC name is (2S,3R,6S)-6-[(1S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-2-[(E)-dec-1-enyl]oxan-3-ol.
| Compound Name | (2S,3R,6S)-6-[(1S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-2-[(E)-dec-1-enyl]oxan-3-ol |
|---|---|
| PubChem CID | 11037372 |
| Molecular Formula | C24H48O4Si |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (2S,3R,6S)-6-[(1S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-2-[(E)-dec-1-enyl]oxan-3-ol |
| SMILES | CCCCCCCC/C=C/[C@@H]1O[C@H]([C@@H](O)CCO[Si](C)(C)C(C)(C)C)CC[C@H]1O |
| InChI | InChI=1S/C24H48O4Si/c1-7-8-9-10-11-12-13-14-15-22-20(25)16-17-23(28-22)21(26)18-19-27-29(5,6)24(2,3)4/h14-15,20-23,25-26H,7-13,16-19H2,1-6H3/b15-14+/t20-,21+,22+,23+/m1/s1 |
| InChIKey | XOLFJLKBAGNXBH-RGXLDMOGSA-N |
| XLogP | 5.97 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|