C27H25NO7 — CID 11038100
[8-[(7-methoxy-4-oxo-2-pyrrolidin-1-ylchromen-3-yl)methyl]-4-methyl-2-oxochromen-7-yl] acetate (PubChem CID 11038100) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is [8-[(7-methoxy-4-oxo-2-pyrrolidin-1-ylchromen-3-yl)methyl]-4-methyl-2-oxochromen-7-yl] acetate.
| Compound Name | [8-[(7-methoxy-4-oxo-2-pyrrolidin-1-ylchromen-3-yl)methyl]-4-methyl-2-oxochromen-7-yl] acetate |
|---|---|
| PubChem CID | 11038100 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | [8-[(7-methoxy-4-oxo-2-pyrrolidin-1-ylchromen-3-yl)methyl]-4-methyl-2-oxochromen-7-yl] acetate |
| SMILES | COc1ccc2c(=O)c(Cc3c(OC(C)=O)ccc4c(C)cc(=O)oc34)c(N3CCCC3)oc2c1 |
| InChI | InChI=1S/C27H25NO7/c1-15-12-24(30)35-26-18(15)8-9-22(33-16(2)29)20(26)14-21-25(31)19-7-6-17(32-3)13-23(19)34-27(21)28-10-4-5-11-28/h6-9,12-13H,4-5,10-11,14H2,1-3H3 |
| InChIKey | BRAUPLZSJJADNE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 99.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|