C30H29NO7S — CID 11038892
[(2S,3R,4R,5S,6R)-3-(1,3-dioxoisoindol-2-yl)-2-ethylsulfanyl-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl] benzoate (PubChem CID 11038892) has the molecular formula C30H29NO7S and a molecular weight of 547.63 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-3-(1,3-dioxoisoindol-2-yl)-2-ethylsulfanyl-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl] benzoate.
| Compound Name | [(2S,3R,4R,5S,6R)-3-(1,3-dioxoisoindol-2-yl)-2-ethylsulfanyl-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 11038892 |
| Molecular Formula | C30H29NO7S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-3-(1,3-dioxoisoindol-2-yl)-2-ethylsulfanyl-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl] benzoate |
| SMILES | CCS[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](OC(=O)c2ccccc2)[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H29NO7S/c1-2-39-30-24(31-27(33)21-15-9-10-16-22(21)28(31)34)26(38-29(35)20-13-7-4-8-14-20)25(32)23(37-30)18-36-17-19-11-5-3-6-12-19/h3-16,23-26,30,32H,2,17-18H2,1H3/t23-,24-,25-,26-,30+/m1/s1 |
| InChIKey | GZQAQDRAXAQDSK-JHBWFYOTSA-N |
| XLogP | 3.93 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|