C25H50NO14P — CID 11039400
[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-octoxyoxan-2-yl]methoxy]oxan-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 11039400) has the molecular formula C25H50NO14P and a molecular weight of 619.64 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-octoxyoxan-2-yl]methoxy]oxan-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-octoxyoxan-2-yl]methoxy]oxan-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 11039400 |
| Molecular Formula | C25H50NO14P |
| Molecular Weight | 619.64 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-octoxyoxan-2-yl]methoxy]oxan-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](CO[C@@H]2O[C@H](COP(=O)([O-])OCC[N+](C)(C)C)[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H50NO14P/c1-5-6-7-8-9-10-12-35-24-22(31)20(29)18(27)16(39-24)14-36-25-23(32)21(30)19(28)17(40-25)15-38-41(33,34)37-13-11-26(2,3)4/h16-25,27-32H,5-15H2,1-4H3/t16-,17-,18+,19+,20+,21+,22-,23-,24-,25-/m1/s1 |
| InChIKey | KPHOMCKNJLVLQC-NZVDZQMQSA-N |
| XLogP | -1.80 |
| TPSA | 216.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.64 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|