C21H17N3O5 — CID 110402400
3-(1,3-dioxoisoindol-2-yl)-N-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]propanamide (PubChem CID 110402400) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]propanamide |
|---|---|
| PubChem CID | 110402400 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]propanamide |
| SMILES | COc1ccc(-c2cnoc2NC(=O)CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H17N3O5/c1-28-14-8-6-13(7-9-14)17-12-22-29-19(17)23-18(25)10-11-24-20(26)15-4-2-3-5-16(15)21(24)27/h2-9,12H,10-11H2,1H3,(H,23,25) |
| InChIKey | JQBVGHXEJJSIBA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|