C13H26OSi — CID 11042448
(6E)-4,4-dimethyl-8-trimethylsilylocta-1,6-dien-3-ol (PubChem CID 11042448) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is (6E)-4,4-dimethyl-8-trimethylsilylocta-1,6-dien-3-ol.
| Compound Name | (6E)-4,4-dimethyl-8-trimethylsilylocta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 11042448 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (6E)-4,4-dimethyl-8-trimethylsilylocta-1,6-dien-3-ol |
| SMILES | C=CC(O)C(C)(C)C/C=C/C[Si](C)(C)C |
| InChI | InChI=1S/C13H26OSi/c1-7-12(14)13(2,3)10-8-9-11-15(4,5)6/h7-9,12,14H,1,10-11H2,2-6H3/b9-8+ |
| InChIKey | UMFJSFWGSGTHLY-CMDGGOBGSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|