C16H20Si — CID 11042866
[3,3-dimethyl-2-(2-phenylethynyl)cyclopropen-1-yl]-trimethylsilane (PubChem CID 11042866) has the molecular formula C16H20Si and a molecular weight of 240.42 g/mol. Its IUPAC name is [3,3-dimethyl-2-(2-phenylethynyl)cyclopropen-1-yl]-trimethylsilane.
| Compound Name | [3,3-dimethyl-2-(2-phenylethynyl)cyclopropen-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11042866 |
| Molecular Formula | C16H20Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | [3,3-dimethyl-2-(2-phenylethynyl)cyclopropen-1-yl]-trimethylsilane |
| SMILES | CC1(C)C(C#Cc2ccccc2)=C1[Si](C)(C)C |
| InChI | InChI=1S/C16H20Si/c1-16(2)14(15(16)17(3,4)5)12-11-13-9-7-6-8-10-13/h6-10H,1-5H3 |
| InChIKey | POBRHKLAVZXUHA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|