C13H16O5 — CID 11043216
methyl (1R,2R,4R,6R,7S)-4-hydroxy-2-methoxy-5-oxotricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate (PubChem CID 11043216) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl (1R,2R,4R,6R,7S)-4-hydroxy-2-methoxy-5-oxotricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate.
| Compound Name | methyl (1R,2R,4R,6R,7S)-4-hydroxy-2-methoxy-5-oxotricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate |
|---|---|
| PubChem CID | 11043216 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | methyl (1R,2R,4R,6R,7S)-4-hydroxy-2-methoxy-5-oxotricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate |
| SMILES | COC(=O)[C@@]1(O)C[C@]2(OC)[C@H](C1=O)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C13H16O5/c1-17-11(15)12(16)6-13(18-2)8-4-3-7(5-8)9(13)10(12)14/h3-4,7-9,16H,5-6H2,1-2H3/t7-,8+,9+,12-,13-/m1/s1 |
| InChIKey | VEPMVEKOYJEIFG-NVPNIBCASA-N |
| XLogP | 0.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|