C15H18N4OS — CID 110432224
2-[(11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)amino]butan-1-ol (PubChem CID 110432224) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[(11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)amino]butan-1-ol.
| Compound Name | 2-[(11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 110432224 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-[(11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)amino]butan-1-ol |
| SMILES | CCC(CO)Nc1ncnc2c1sc1nc(C)cc(C)c12 |
| InChI | InChI=1S/C15H18N4OS/c1-4-10(6-20)19-14-13-12(16-7-17-14)11-8(2)5-9(3)18-15(11)21-13/h5,7,10,20H,4,6H2,1-3H3,(H,16,17,19) |
| InChIKey | IXJMKLCDJLSIDG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |