C13H13FN2O3 — CID 11043632
N-benzyl-2-(2,5-dioxopyrrolidin-1-yl)-2-fluoroacetamide (PubChem CID 11043632) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is N-benzyl-2-(2,5-dioxopyrrolidin-1-yl)-2-fluoroacetamide.
| Compound Name | N-benzyl-2-(2,5-dioxopyrrolidin-1-yl)-2-fluoroacetamide |
|---|---|
| PubChem CID | 11043632 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-benzyl-2-(2,5-dioxopyrrolidin-1-yl)-2-fluoroacetamide |
| SMILES | O=C(NCc1ccccc1)C(F)N1C(=O)CCC1=O |
| InChI | InChI=1S/C13H13FN2O3/c14-12(16-10(17)6-7-11(16)18)13(19)15-8-9-4-2-1-3-5-9/h1-5,12H,6-8H2,(H,15,19) |
| InChIKey | KKSYPTXIJFRJPV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|