C17H18FN3O3 — CID 110439644
ethyl 5-[[1-(4-fluorophenyl)cyclopropanecarbonyl]amino]-1-methylpyrazole-4-carboxylate (PubChem CID 110439644) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is ethyl 5-[[1-(4-fluorophenyl)cyclopropanecarbonyl]amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[1-(4-fluorophenyl)cyclopropanecarbonyl]amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 110439644 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | ethyl 5-[[1-(4-fluorophenyl)cyclopropanecarbonyl]amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)C1(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H18FN3O3/c1-3-24-15(22)13-10-19-21(2)14(13)20-16(23)17(8-9-17)11-4-6-12(18)7-5-11/h4-7,10H,3,8-9H2,1-2H3,(H,20,23) |
| InChIKey | DLASXNJAXGBDEH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |