C18H21N3O4 — CID 110439670
ethyl 5-[[1-(2-methoxyphenyl)cyclopropanecarbonyl]amino]-1-methylpyrazole-4-carboxylate (PubChem CID 110439670) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is ethyl 5-[[1-(2-methoxyphenyl)cyclopropanecarbonyl]amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[1-(2-methoxyphenyl)cyclopropanecarbonyl]amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 110439670 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | ethyl 5-[[1-(2-methoxyphenyl)cyclopropanecarbonyl]amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)C1(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C18H21N3O4/c1-4-25-16(22)12-11-19-21(2)15(12)20-17(23)18(9-10-18)13-7-5-6-8-14(13)24-3/h5-8,11H,4,9-10H2,1-3H3,(H,20,23) |
| InChIKey | MFDKIEPKJFFELM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |