C13H15N3O3 — CID 110456272
N-(1,3-benzodioxol-5-yl)-5-tert-butyl-1,3,4-oxadiazol-2-amine (PubChem CID 110456272) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-tert-butyl-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-tert-butyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 110456272 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-tert-butyl-1,3,4-oxadiazol-2-amine |
| SMILES | CC(C)(C)c1nnc(Nc2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C13H15N3O3/c1-13(2,3)11-15-16-12(19-11)14-8-4-5-9-10(6-8)18-7-17-9/h4-6H,7H2,1-3H3,(H,14,16) |
| InChIKey | XRRVNRFGFBULCC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |