C12H8N6O5 — CID 135515041
N-(1,3-benzodioxol-5-yl)-5-(5-nitro-1H-imidazol-4-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 135515041) has the molecular formula C12H8N6O5 and a molecular weight of 316.23 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-(5-nitro-1H-imidazol-4-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-(5-nitro-1H-imidazol-4-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 135515041 |
| Molecular Formula | C12H8N6O5 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-(5-nitro-1H-imidazol-4-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | O=[N+]([O-])c1[nH]cnc1-c1nnc(Nc2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C12H8N6O5/c19-18(20)10-9(13-4-14-10)11-16-17-12(23-11)15-6-1-2-7-8(3-6)22-5-21-7/h1-4H,5H2,(H,13,14)(H,15,17) |
| InChIKey | LXHQXAUXZYNQRH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 141.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|