C22H18O5 — CID 11046658
(8-hydroxyspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene]-8'-yl) acetate (PubChem CID 11046658) has the molecular formula C22H18O5 and a molecular weight of 362.38 g/mol. Its IUPAC name is (8-hydroxyspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene]-8'-yl) acetate.
| Compound Name | (8-hydroxyspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene]-8'-yl) acetate |
|---|---|
| PubChem CID | 11046658 |
| Molecular Formula | C22H18O5 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (8-hydroxyspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene]-8'-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c3c(cccc13)OC1(CCCc3c(O)cccc31)O2 |
| InChI | InChI=1S/C22H18O5/c1-13(23)25-18-10-11-20-21-15(18)5-2-9-19(21)26-22(27-20)12-4-6-14-16(22)7-3-8-17(14)24/h2-3,5,7-11,24H,4,6,12H2,1H3 |
| InChIKey | IWSKDQDVYPFTCV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|